C9H8Cl2N2O6S — CID 104861899
(2S)-2-[(2,4-dichloro-3-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 104861899) has the molecular formula C9H8Cl2N2O6S and a molecular weight of 343.14 g/mol. Its IUPAC name is (2S)-2-[(2,4-dichloro-3-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[(2,4-dichloro-3-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 104861899 |
| Molecular Formula | C9H8Cl2N2O6S |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | (2S)-2-[(2,4-dichloro-3-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1Cl)C(=O)O |
| InChI | InChI=1S/C9H8Cl2N2O6S/c1-4(9(14)15)12-20(18,19)6-3-2-5(10)8(7(6)11)13(16)17/h2-4,12H,1H3,(H,14,15)/t4-/m0/s1 |
| InChIKey | OLSOTBOPYPVCBR-BYPYZUCNSA-N |
| XLogP | 1.65 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|