C11H22OS — CID 104863820
1,2-dimethyl-4-(2-methylsulfanylethoxy)cyclohexane (PubChem CID 104863820) has the molecular formula C11H22OS and a molecular weight of 202.36 g/mol. Its IUPAC name is 1,2-dimethyl-4-(2-methylsulfanylethoxy)cyclohexane.
| Compound Name | 1,2-dimethyl-4-(2-methylsulfanylethoxy)cyclohexane |
|---|---|
| PubChem CID | 104863820 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1,2-dimethyl-4-(2-methylsulfanylethoxy)cyclohexane |
| SMILES | CSCCOC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C11H22OS/c1-9-4-5-11(8-10(9)2)12-6-7-13-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | JJNMETJOTKBZTN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|