(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid

C12H13Cl2NO4 — CID 104875680

IUPAC(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid
SMILESC[C@@H](OCCC(=O)Nc1c(Cl)cccc1Cl)C(=O)O
InChIInChI=1S/C12H13Cl2NO4/c1-7(12(17)18)19-6-5-10(16)15-11-8(13)3-2-4-9(11)14/h2-4,7H,5-6H2,1H3,(H,15,16)(H,17,18)/t7-/m1/s1
InChIKeyDRHFLYMTTBWNMA-SSDOTTSWSA-N
MW306.14 g/mol
LogP2.81
Rot. Bonds6

About (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid

(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid (PubChem CID 104875680) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.14 g/mol. Its IUPAC name is (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid
PubChem CID104875680
Molecular FormulaC12H13Cl2NO4
Molecular Weight306.14 g/mol
Exact Mass305.02
IUPAC Name(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid
SMILESC[C@@H](OCCC(=O)Nc1c(Cl)cccc1Cl)C(=O)O
InChIInChI=1S/C12H13Cl2NO4/c1-7(12(17)18)19-6-5-10(16)15-11-8(13)3-2-4-9(11)14/h2-4,7H,5-6H2,1H3,(H,15,16)(H,17,18)/t7-/m1/s1
InChIKeyDRHFLYMTTBWNMA-SSDOTTSWSA-N
XLogP2.81
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.14
LogP ≤ 52.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid?
The IUPAC name of (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid (CID 104875680) is (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid?
The canonical SMILES for (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid is C[C@@H](OCCC(=O)Nc1c(Cl)cccc1Cl)C(=O)O.
What is the InChIKey of (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid?
The InChIKey is DRHFLYMTTBWNMA-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H13Cl2NO4/c1-7(12(17)18)19-6-5-10(16)15-11-8(13)3-2-4-9(11)14/h2-4,7H,5-6H2,1H3,(H,15,16)(H,17,18)/t7-/m1/s1.
What are the key properties of (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid?
(2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid has a molecular weight of 306.14 g/mol, XLogP of 2.81, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[3-(2,6-dichloroanilino)-3-oxopropoxy]propanoic acid is sourced from PubChem (CID 104875680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).