C11H21N5OS — CID 104884465
3-amino-2-(3-ethoxypropyl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)guanidine (PubChem CID 104884465) has the molecular formula C11H21N5OS and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-amino-2-(3-ethoxypropyl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)guanidine.
| Compound Name | 3-amino-2-(3-ethoxypropyl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104884465 |
| Molecular Formula | C11H21N5OS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-amino-2-(3-ethoxypropyl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)guanidine |
| SMILES | CCOCCC/N=C(\NN)N(C)Cc1cscn1 |
| InChI | InChI=1S/C11H21N5OS/c1-3-17-6-4-5-13-11(15-12)16(2)7-10-8-18-9-14-10/h8-9H,3-7,12H2,1-2H3,(H,13,15) |
| InChIKey | HPEIWJIPFWPPMY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|