C13H24N4OS — CID 116514461
3-amino-2-(3-ethoxypropyl)-1-ethyl-1-(thiophen-2-ylmethyl)guanidine (PubChem CID 116514461) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-amino-2-(3-ethoxypropyl)-1-ethyl-1-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 3-amino-2-(3-ethoxypropyl)-1-ethyl-1-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 116514461 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-amino-2-(3-ethoxypropyl)-1-ethyl-1-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCOCCC/N=C(\NN)N(CC)Cc1cccs1 |
| InChI | InChI=1S/C13H24N4OS/c1-3-17(11-12-7-5-10-19-12)13(16-14)15-8-6-9-18-4-2/h5,7,10H,3-4,6,8-9,11,14H2,1-2H3,(H,15,16) |
| InChIKey | XVPJMOJAJQEWFV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|