C9H18O5 — CID 10488486
(3R,4R)-4,5-bis(methoxymethoxy)pent-1-en-3-ol (PubChem CID 10488486) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3R,4R)-4,5-bis(methoxymethoxy)pent-1-en-3-ol.
| Compound Name | (3R,4R)-4,5-bis(methoxymethoxy)pent-1-en-3-ol |
|---|---|
| PubChem CID | 10488486 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (3R,4R)-4,5-bis(methoxymethoxy)pent-1-en-3-ol |
| SMILES | C=C[C@@H](O)[C@@H](COCOC)OCOC |
| InChI | InChI=1S/C9H18O5/c1-4-8(10)9(14-7-12-3)5-13-6-11-2/h4,8-10H,1,5-7H2,2-3H3/t8-,9-/m1/s1 |
| InChIKey | IFSGRLIYVMSQNC-RKDXNWHRSA-N |
| XLogP | 0.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|