C13H29N5O2 — CID 104887114
N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)-4-hydroxypyrrolidine-1-carboximidamide (PubChem CID 104887114) has the molecular formula C13H29N5O2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)-4-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)-4-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104887114 |
| Molecular Formula | C13H29N5O2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)-4-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CC(O)CC1CN(C)C |
| InChI | InChI=1S/C13H29N5O2/c1-4-20-7-5-6-15-13(16-14)18-10-12(19)8-11(18)9-17(2)3/h11-12,19H,4-10,14H2,1-3H3,(H,15,16) |
| InChIKey | LQAASDMACMVYAZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|