C8H9N5OS — CID 10489271
5-amino-3-(furan-2-yl)-N-methyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10489271) has the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. Its IUPAC name is 5-amino-3-(furan-2-yl)-N-methyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-3-(furan-2-yl)-N-methyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10489271 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 5-amino-3-(furan-2-yl)-N-methyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CNC(=S)n1nc(-c2ccco2)nc1N |
| InChI | InChI=1S/C8H9N5OS/c1-10-8(15)13-7(9)11-6(12-13)5-3-2-4-14-5/h2-4H,1H3,(H,10,15)(H2,9,11,12) |
| InChIKey | RNOFDXJBPCYKJV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|