C14H18N2Si — CID 10490380
(3R,7S)-5,5-dimethyl-5-silatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile (PubChem CID 10490380) has the molecular formula C14H18N2Si and a molecular weight of 242.40 g/mol. Its IUPAC name is (3R,7S)-5,5-dimethyl-5-silatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile.
| Compound Name | (3R,7S)-5,5-dimethyl-5-silatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 10490380 |
| Molecular Formula | C14H18N2Si |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3R,7S)-5,5-dimethyl-5-silatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile |
| SMILES | C[Si]1(C)C[C@H]2CC3C[C@@H](C1)C2C(C#N)=C3C#N |
| InChI | InChI=1S/C14H18N2Si/c1-17(2)7-10-3-9-4-11(8-17)14(10)13(6-16)12(9)5-15/h9-11,14H,3-4,7-8H2,1-2H3/t9?,10-,11+,14? |
| InChIKey | UMTXUJGCKBTXOT-ZNBHRWMRSA-N |
| XLogP | 3.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|