C14H14N2 — CID 10822355
(1S,4R,5S,8R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-10,11-dicarbonitrile (PubChem CID 10822355) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (1S,4R,5S,8R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-10,11-dicarbonitrile.
| Compound Name | (1S,4R,5S,8R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-10,11-dicarbonitrile |
|---|---|
| PubChem CID | 10822355 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (1S,4R,5S,8R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-10,11-dicarbonitrile |
| SMILES | N#CC1=C(C#N)C2[C@H]3CC[C@@H]2[C@@H]2CC[C@H]3C12 |
| InChI | InChI=1S/C14H14N2/c15-5-11-12(6-16)14-9-3-4-10(14)8-2-1-7(9)13(8)11/h7-10,13-14H,1-4H2/t7-,8+,9+,10-,13?,14? |
| InChIKey | UFZYPPQKUSBCLL-XZQMURHDSA-N |
| XLogP | 2.64 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |