C13H14N4S — CID 790242
2,6-diamino-4-[(1R)-cyclohex-3-en-1-yl]-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 790242) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 2,6-diamino-4-[(1R)-cyclohex-3-en-1-yl]-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-[(1R)-cyclohex-3-en-1-yl]-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 790242 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2,6-diamino-4-[(1R)-cyclohex-3-en-1-yl]-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)SC(N)=C(C#N)C1[C@H]1CC=CCC1 |
| InChI | InChI=1S/C13H14N4S/c14-6-9-11(8-4-2-1-3-5-8)10(7-15)13(17)18-12(9)16/h1-2,8,11H,3-5,16-17H2/t8-/m0/s1 |
| InChIKey | IPZCDWLMVIKJAK-QMMMGPOBSA-N |
| XLogP | 2.09 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|