C7H8N2OS — CID 51703716
(2R)-4-methyl-6-oxo-2-sulfanyl-2,5-dihydro-1H-pyridine-3-carbonitrile (PubChem CID 51703716) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is (2R)-4-methyl-6-oxo-2-sulfanyl-2,5-dihydro-1H-pyridine-3-carbonitrile.
| Compound Name | (2R)-4-methyl-6-oxo-2-sulfanyl-2,5-dihydro-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 51703716 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (2R)-4-methyl-6-oxo-2-sulfanyl-2,5-dihydro-1H-pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)[C@@H](S)NC(=O)C1 |
| InChI | InChI=1S/C7H8N2OS/c1-4-2-6(10)9-7(11)5(4)3-8/h7,11H,2H2,1H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | LAYNILYGZIBMSF-SSDOTTSWSA-N |
| XLogP | 0.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|