C16H20N2 — CID 10538037
(1R,3R,6R,7S,8S)-2,2,6-trimethyltricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile (PubChem CID 10538037) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1R,3R,6R,7S,8S)-2,2,6-trimethyltricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile.
| Compound Name | (1R,3R,6R,7S,8S)-2,2,6-trimethyltricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 10538037 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (1R,3R,6R,7S,8S)-2,2,6-trimethyltricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarbonitrile |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]3C(C#N)=C(C#N)[C@H](C[C@H]31)C2(C)C |
| InChI | InChI=1S/C16H20N2/c1-9-4-5-13-15-10(9)6-14(16(13,2)3)11(7-17)12(15)8-18/h9-10,13-15H,4-6H2,1-3H3/t9-,10+,13-,14+,15-/m1/s1 |
| InChIKey | UNYXGOAFVNOIPA-AVFNUOGKSA-N |
| XLogP | 3.67 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |