C14H28N2O3S — CID 104908546
4-[2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]-5-methylhexanoic acid (PubChem CID 104908546) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]-5-methylhexanoic acid.
| Compound Name | 4-[2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 104908546 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]-5-methylhexanoic acid |
| SMILES | CSCC[C@@H](N)C(=O)NCCC(CCC(=O)O)C(C)C |
| InChI | InChI=1S/C14H28N2O3S/c1-10(2)11(4-5-13(17)18)6-8-16-14(19)12(15)7-9-20-3/h10-12H,4-9,15H2,1-3H3,(H,16,19)(H,17,18)/t11?,12-/m1/s1 |
| InChIKey | HONJFVZGTGJKEI-PIJUOVFKSA-N |
| XLogP | 1.71 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |