C12H14O6 — CID 10491136
[(2S)-3-[(2S,6S)-6-hydroxy-5-methyl-3,6-dihydro-2H-pyran-2-yl]-5-oxo-2H-furan-2-yl] acetate (PubChem CID 10491136) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is [(2S)-3-[(2S,6S)-6-hydroxy-5-methyl-3,6-dihydro-2H-pyran-2-yl]-5-oxo-2H-furan-2-yl] acetate.
| Compound Name | [(2S)-3-[(2S,6S)-6-hydroxy-5-methyl-3,6-dihydro-2H-pyran-2-yl]-5-oxo-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 10491136 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [(2S)-3-[(2S,6S)-6-hydroxy-5-methyl-3,6-dihydro-2H-pyran-2-yl]-5-oxo-2H-furan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC(=O)C=C1[C@@H]1CC=C(C)[C@@H](O)O1 |
| InChI | InChI=1S/C12H14O6/c1-6-3-4-9(17-11(6)15)8-5-10(14)18-12(8)16-7(2)13/h3,5,9,11-12,15H,4H2,1-2H3/t9-,11-,12-/m0/s1 |
| InChIKey | YMKVJABMJUVUAQ-DLOVCJGASA-N |
| XLogP | 0.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|