C13H20O3S — CID 10491323
[2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylmethyl acetate (PubChem CID 10491323) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is [2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylmethyl acetate.
| Compound Name | [2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylmethyl acetate |
|---|---|
| PubChem CID | 10491323 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [2-(2,3,3-trimethylcyclopenten-1-yl)acetyl]sulfanylmethyl acetate |
| SMILES | CC(=O)OCSC(=O)CC1=C(C)C(C)(C)CC1 |
| InChI | InChI=1S/C13H20O3S/c1-9-11(5-6-13(9,3)4)7-12(15)17-8-16-10(2)14/h5-8H2,1-4H3 |
| InChIKey | HZHGBZVMILDPJK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|