C14H22O3S — CID 10563999
[2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]acetyl]sulfanylmethyl propanoate (PubChem CID 10563999) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is [2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]acetyl]sulfanylmethyl propanoate.
| Compound Name | [2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]acetyl]sulfanylmethyl propanoate |
|---|---|
| PubChem CID | 10563999 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]acetyl]sulfanylmethyl propanoate |
| SMILES | CCC(=O)OCSC(=O)C[C@@H]1CC=C(C)C1(C)C |
| InChI | InChI=1S/C14H22O3S/c1-5-12(15)17-9-18-13(16)8-11-7-6-10(2)14(11,3)4/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | UKSPHTMNDFDACL-NSHDSACASA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|