C14H24OS — CID 10633816
S-butyl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate (PubChem CID 10633816) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is S-butyl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate.
| Compound Name | S-butyl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate |
|---|---|
| PubChem CID | 10633816 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | S-butyl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate |
| SMILES | CCCCSC(=O)CC1CC=C(C)C1(C)C |
| InChI | InChI=1S/C14H24OS/c1-5-6-9-16-13(15)10-12-8-7-11(2)14(12,3)4/h7,12H,5-6,8-10H2,1-4H3 |
| InChIKey | RDCWOIOKRJIWDH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|