C17H29OS+ — CID 59503012
3,3-dimethyl-1-(4-methylcyclohex-3-en-1-yl)-2-(thiolan-1-ium-1-yl)butan-1-one (PubChem CID 59503012) has the molecular formula C17H29OS+ and a molecular weight of 281.48 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methylcyclohex-3-en-1-yl)-2-(thiolan-1-ium-1-yl)butan-1-one.
| Compound Name | 3,3-dimethyl-1-(4-methylcyclohex-3-en-1-yl)-2-(thiolan-1-ium-1-yl)butan-1-one |
|---|---|
| PubChem CID | 59503012 |
| Molecular Formula | C17H29OS+ |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3,3-dimethyl-1-(4-methylcyclohex-3-en-1-yl)-2-(thiolan-1-ium-1-yl)butan-1-one |
| SMILES | CC1=CCC(C(=O)C([S+]2CCCC2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29OS/c1-13-7-9-14(10-8-13)15(18)16(17(2,3)4)19-11-5-6-12-19/h7,14,16H,5-6,8-12H2,1-4H3/q+1 |
| InChIKey | GBQRACPJVAFHBA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|