C14H24OS — CID 10586161
S-(2-methylpropyl) 2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethanethioate (PubChem CID 10586161) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is S-(2-methylpropyl) 2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethanethioate.
| Compound Name | S-(2-methylpropyl) 2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethanethioate |
|---|---|
| PubChem CID | 10586161 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | S-(2-methylpropyl) 2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethanethioate |
| SMILES | CC1=CC[C@@H](CC(=O)SCC(C)C)C1(C)C |
| InChI | InChI=1S/C14H24OS/c1-10(2)9-16-13(15)8-12-7-6-11(3)14(12,4)5/h6,10,12H,7-9H2,1-5H3/t12-/m0/s1 |
| InChIKey | WFHZAAZRPULZRR-LBPRGKRZSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|