C13H22OS — CID 10585374
S-propan-2-yl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate (PubChem CID 10585374) has the molecular formula C13H22OS and a molecular weight of 226.38 g/mol. Its IUPAC name is S-propan-2-yl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate.
| Compound Name | S-propan-2-yl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate |
|---|---|
| PubChem CID | 10585374 |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | S-propan-2-yl 2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethanethioate |
| SMILES | CC1=CCC(CC(=O)SC(C)C)C1(C)C |
| InChI | InChI=1S/C13H22OS/c1-9(2)15-12(14)8-11-7-6-10(3)13(11,4)5/h6,9,11H,7-8H2,1-5H3 |
| InChIKey | UOLZJFHFXMYDCU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|