C13H17F5 — CID 10492093
8a-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 10492093) has the molecular formula C13H17F5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 8a-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | 8a-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 10492093 |
| Molecular Formula | C13H17F5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 8a-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | F/C(=C(\F)C12CCCCC1CCCC2)C(F)(F)F |
| InChI | InChI=1S/C13H17F5/c14-10(11(15)13(16,17)18)12-7-3-1-5-9(12)6-2-4-8-12/h9H,1-8H2/b11-10- |
| InChIKey | UKIUDYSQFZOQGV-KHPPLWFESA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |