C12H10F8 — CID 549032
1,8,9,10,11,11,12,12-octafluorotricyclo[6.2.2.02,7]dodec-9-ene (PubChem CID 549032) has the molecular formula C12H10F8 and a molecular weight of 306.20 g/mol. Its IUPAC name is 1,8,9,10,11,11,12,12-octafluorotricyclo[6.2.2.02,7]dodec-9-ene.
| Compound Name | 1,8,9,10,11,11,12,12-octafluorotricyclo[6.2.2.02,7]dodec-9-ene |
|---|---|
| PubChem CID | 549032 |
| Molecular Formula | C12H10F8 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1,8,9,10,11,11,12,12-octafluorotricyclo[6.2.2.02,7]dodec-9-ene |
| SMILES | FC1=C(F)C2(F)C3CCCCC3C1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C12H10F8/c13-7-8(14)10(16)6-4-2-1-3-5(6)9(7,15)11(17,18)12(10,19)20/h5-6H,1-4H2 |
| InChIKey | NXAAAVOVWDQDIU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|