C20H30F4 — CID 58665446
2-methyl-6-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 58665446) has the molecular formula C20H30F4 and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-methyl-6-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-methyl-6-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 58665446 |
| Molecular Formula | C20H30F4 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-methyl-6-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CC(C3CCC(C=C(F)C(F)(F)F)CC3)CCC2C1 |
| InChI | InChI=1S/C20H30F4/c1-13-2-5-18-12-17(9-8-16(18)10-13)15-6-3-14(4-7-15)11-19(21)20(22,23)24/h11,13-18H,2-10,12H2,1H3 |
| InChIKey | HVYOJHIKSFTDER-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |