C13H17F5 — CID 10849478
(1S,4aR,8aS)-1-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 10849478) has the molecular formula C13H17F5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (1S,4aR,8aS)-1-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (1S,4aR,8aS)-1-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 10849478 |
| Molecular Formula | C13H17F5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1S,4aR,8aS)-1-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | F/C(=C(\F)C(F)(F)F)[C@H]1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C13H17F5/c14-11(12(15)13(16,17)18)10-7-3-5-8-4-1-2-6-9(8)10/h8-10H,1-7H2/b12-11-/t8-,9+,10+/m1/s1 |
| InChIKey | RKQUUQWCSOKESD-DMNGHILWSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |