C14H19ClO3 — CID 10492308
(Z,2S,6S)-7-chloro-1-phenylmethoxyhept-3-ene-2,6-diol (PubChem CID 10492308) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is (Z,2S,6S)-7-chloro-1-phenylmethoxyhept-3-ene-2,6-diol.
| Compound Name | (Z,2S,6S)-7-chloro-1-phenylmethoxyhept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 10492308 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (Z,2S,6S)-7-chloro-1-phenylmethoxyhept-3-ene-2,6-diol |
| SMILES | O[C@H](CCl)C/C=C\[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C14H19ClO3/c15-9-13(16)7-4-8-14(17)11-18-10-12-5-2-1-3-6-12/h1-6,8,13-14,16-17H,7,9-11H2/b8-4-/t13-,14-/m0/s1 |
| InChIKey | AWVBTEGWCRMBJG-GHGQEBASSA-N |
| XLogP | 2.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|