C19H20O2Se — CID 102403075
(2R,3E,5E)-1-phenylmethoxy-6-phenylselanylhexa-3,5-dien-2-ol (PubChem CID 102403075) has the molecular formula C19H20O2Se and a molecular weight of 359.33 g/mol. Its IUPAC name is (2R,3E,5E)-1-phenylmethoxy-6-phenylselanylhexa-3,5-dien-2-ol.
| Compound Name | (2R,3E,5E)-1-phenylmethoxy-6-phenylselanylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 102403075 |
| Molecular Formula | C19H20O2Se |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (2R,3E,5E)-1-phenylmethoxy-6-phenylselanylhexa-3,5-dien-2-ol |
| SMILES | O[C@H](/C=C/C=C/[Se]c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C19H20O2Se/c20-18(16-21-15-17-9-3-1-4-10-17)11-7-8-14-22-19-12-5-2-6-13-19/h1-14,18,20H,15-16H2/b11-7+,14-8+/t18-/m1/s1 |
| InChIKey | JDALBLHSSFCXTO-HKOMADEHSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|