C20H22O3 — CID 10542988
(2S,3S,4E,6E)-7-phenyl-1-phenylmethoxyhepta-4,6-diene-2,3-diol (PubChem CID 10542988) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S,3S,4E,6E)-7-phenyl-1-phenylmethoxyhepta-4,6-diene-2,3-diol.
| Compound Name | (2S,3S,4E,6E)-7-phenyl-1-phenylmethoxyhepta-4,6-diene-2,3-diol |
|---|---|
| PubChem CID | 10542988 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2S,3S,4E,6E)-7-phenyl-1-phenylmethoxyhepta-4,6-diene-2,3-diol |
| SMILES | O[C@@H](/C=C/C=C/c1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H22O3/c21-19(14-8-7-11-17-9-3-1-4-10-17)20(22)16-23-15-18-12-5-2-6-13-18/h1-14,19-22H,15-16H2/b11-7+,14-8+/t19-,20-/m0/s1 |
| InChIKey | STUIQSFENBPBLQ-VWTYLBPOSA-N |
| XLogP | 3.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|