C13H25F3N2S — CID 104926351
N-(5-methylsulfanylpentyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 104926351) has the molecular formula C13H25F3N2S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-(5-methylsulfanylpentyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(5-methylsulfanylpentyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 104926351 |
| Molecular Formula | C13H25F3N2S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(5-methylsulfanylpentyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | CSCCCCCNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N2S/c1-19-10-4-2-3-7-17-12-5-8-18(9-6-12)11-13(14,15)16/h12,17H,2-11H2,1H3 |
| InChIKey | KVHOXKKDVXWXOY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|