C15H17NO2S — CID 10492656
(6S,7S)-7-ethenyl-6-(4-methoxyphenyl)-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 10492656) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is (6S,7S)-7-ethenyl-6-(4-methoxyphenyl)-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6S,7S)-7-ethenyl-6-(4-methoxyphenyl)-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10492656 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (6S,7S)-7-ethenyl-6-(4-methoxyphenyl)-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C=C[C@H]1C(=O)N2CCCS[C@]12c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H17NO2S/c1-3-13-14(17)16-9-4-10-19-15(13,16)11-5-7-12(18-2)8-6-11/h3,5-8,13H,1,4,9-10H2,2H3/t13-,15+/m0/s1 |
| InChIKey | IEGHIOJZXAZZCL-DZGCQCFKSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|