C15H18O2 — CID 134963153
trans-(2R,4R)-2-(4-methoxyphenyl)-4-methyl-2-prop-2-enylcyclobutan-1-one (PubChem CID 134963153) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is trans-(2R,4R)-2-(4-methoxyphenyl)-4-methyl-2-prop-2-enylcyclobutan-1-one.
| Compound Name | trans-(2R,4R)-2-(4-methoxyphenyl)-4-methyl-2-prop-2-enylcyclobutan-1-one |
|---|---|
| PubChem CID | 134963153 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | trans-(2R,4R)-2-(4-methoxyphenyl)-4-methyl-2-prop-2-enylcyclobutan-1-one |
| SMILES | C=CC[C@]1(c2ccc(OC)cc2)C[C@@H](C)C1=O |
| InChI | InChI=1S/C15H18O2/c1-4-9-15(10-11(2)14(15)16)12-5-7-13(17-3)8-6-12/h4-8,11H,1,9-10H2,2-3H3/t11-,15-/m1/s1 |
| InChIKey | FCPUZVQFZGSFHW-IAQYHMDHSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|