C21H24O — CID 172756052
4-(4-methoxyphenyl)-3-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene (PubChem CID 172756052) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(4-methoxyphenyl)-3-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 172756052 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene |
| SMILES | C=CCC1(c2ccc(OC)cc2)c2ccccc2CCC1C |
| InChI | InChI=1S/C21H24O/c1-4-15-21(18-11-13-19(22-3)14-12-18)16(2)9-10-17-7-5-6-8-20(17)21/h4-8,11-14,16H,1,9-10,15H2,2-3H3 |
| InChIKey | LAQIOXDMVPUNJL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|