C19H22N2 — CID 11403204
2-[(1R,2R)-2-propan-2-yl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile (PubChem CID 11403204) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[(1R,2R)-2-propan-2-yl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile.
| Compound Name | 2-[(1R,2R)-2-propan-2-yl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 11403204 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-[(1R,2R)-2-propan-2-yl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile |
| SMILES | C=CC[C@@]1(C(C#N)C#N)c2ccccc2CC[C@@H]1C(C)C |
| InChI | InChI=1S/C19H22N2/c1-4-11-19(16(12-20)13-21)17(14(2)3)10-9-15-7-5-6-8-18(15)19/h4-8,14,16-17H,1,9-11H2,2-3H3/t17-,19+/m1/s1 |
| InChIKey | GIQADXDHADYNBG-MJGOQNOKSA-N |
| XLogP | 4.38 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|