C17H18N2 — CID 101147170
2-[(1R)-2-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile (PubChem CID 101147170) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[(1R)-2-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile.
| Compound Name | 2-[(1R)-2-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 101147170 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[(1R)-2-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-yl]propanedinitrile |
| SMILES | C=CC[C@@]1(C(C#N)C#N)c2ccccc2CCC1C |
| InChI | InChI=1S/C17H18N2/c1-3-10-17(15(11-18)12-19)13(2)8-9-14-6-4-5-7-16(14)17/h3-7,13,15H,1,8-10H2,2H3/t13?,17-/m1/s1 |
| InChIKey | LOUROCKOTXZZGK-LRHAYUFXSA-N |
| XLogP | 3.75 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|