C13H17N — CID 75162996
3-methyl-1-prop-2-enyl-2,3-dihydroinden-1-amine (PubChem CID 75162996) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-methyl-1-prop-2-enyl-2,3-dihydroinden-1-amine.
| Compound Name | 3-methyl-1-prop-2-enyl-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 75162996 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-methyl-1-prop-2-enyl-2,3-dihydroinden-1-amine |
| SMILES | C=CCC1(N)CC(C)c2ccccc21 |
| InChI | InChI=1S/C13H17N/c1-3-8-13(14)9-10(2)11-6-4-5-7-12(11)13/h3-7,10H,1,8-9,14H2,2H3 |
| InChIKey | IEBBVOVLAJAXAK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|