About 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate
2,2-dimethylpropyl difluoro(phenyl)methanesulfonate (PubChem CID 10492844) has the molecular formula C12H16F2O3S
and a molecular weight of 278.32 g/mol. Its IUPAC name is 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate |
| PubChem CID | 10492844 |
| Molecular Formula | C12H16F2O3S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate |
| SMILES | CC(C)(C)COS(=O)(=O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C12H16F2O3S/c1-11(2,3)9-17-18(15,16)12(13,14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | XAZVYXHESILDSP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate?
The IUPAC name of 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate (CID 10492844) is 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate.
What is the SMILES notation for 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate?
The canonical SMILES for 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate is CC(C)(C)COS(=O)(=O)C(F)(F)c1ccccc1.
What is the InChIKey of 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate?
The InChIKey is XAZVYXHESILDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O3S/c1-11(2,3)9-17-18(15,16)12(13,14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3.
What are the key properties of 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate?
2,2-dimethylpropyl difluoro(phenyl)methanesulfonate has a molecular weight of 278.32 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl difluoro(phenyl)methanesulfonate is sourced from PubChem (CID 10492844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).