C17H30N2O4 — CID 104933585
tert-butyl 4-(3-methoxycarbonylpent-2-enyl)-1,4-diazepane-1-carboxylate (PubChem CID 104933585) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxycarbonylpent-2-enyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(3-methoxycarbonylpent-2-enyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 104933585 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | tert-butyl 4-(3-methoxycarbonylpent-2-enyl)-1,4-diazepane-1-carboxylate |
| SMILES | CCC(=CCN1CCCN(C(=O)OC(C)(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C17H30N2O4/c1-6-14(15(20)22-5)8-11-18-9-7-10-19(13-12-18)16(21)23-17(2,3)4/h8H,6-7,9-13H2,1-5H3 |
| InChIKey | MVFKNXRMFQFAAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|