C11H12ClN5OS — CID 10494269
5-amino-3-(4-chloro-2-methoxyphenyl)-N-methyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10494269) has the molecular formula C11H12ClN5OS and a molecular weight of 297.77 g/mol. Its IUPAC name is 5-amino-3-(4-chloro-2-methoxyphenyl)-N-methyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-3-(4-chloro-2-methoxyphenyl)-N-methyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10494269 |
| Molecular Formula | C11H12ClN5OS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-amino-3-(4-chloro-2-methoxyphenyl)-N-methyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CNC(=S)n1nc(-c2ccc(Cl)cc2OC)nc1N |
| InChI | InChI=1S/C11H12ClN5OS/c1-14-11(19)17-10(13)15-9(16-17)7-4-3-6(12)5-8(7)18-2/h3-5H,1-2H3,(H,14,19)(H2,13,15,16) |
| InChIKey | IIQLNGUNPUMANJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|