C17H17NO2 — CID 104952320
(2R)-2-amino-1-(3,4-dihydro-2H-chromen-8-yl)-2-phenylethanone (PubChem CID 104952320) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2R)-2-amino-1-(3,4-dihydro-2H-chromen-8-yl)-2-phenylethanone.
| Compound Name | (2R)-2-amino-1-(3,4-dihydro-2H-chromen-8-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 104952320 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-2-amino-1-(3,4-dihydro-2H-chromen-8-yl)-2-phenylethanone |
| SMILES | N[C@@H](C(=O)c1cccc2c1OCCC2)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c18-15(12-6-2-1-3-7-12)16(19)14-10-4-8-13-9-5-11-20-17(13)14/h1-4,6-8,10,15H,5,9,11,18H2/t15-/m1/s1 |
| InChIKey | GUMRIXJYSLDGRW-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |