C16H19NO6 — CID 10495993
methyl 2-[(1R,2S)-1-acetamido-2-methoxycarbonyl-3-oxobutyl]benzoate (PubChem CID 10495993) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 2-[(1R,2S)-1-acetamido-2-methoxycarbonyl-3-oxobutyl]benzoate.
| Compound Name | methyl 2-[(1R,2S)-1-acetamido-2-methoxycarbonyl-3-oxobutyl]benzoate |
|---|---|
| PubChem CID | 10495993 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl 2-[(1R,2S)-1-acetamido-2-methoxycarbonyl-3-oxobutyl]benzoate |
| SMILES | COC(=O)c1ccccc1[C@H](NC(C)=O)[C@@H](C(C)=O)C(=O)OC |
| InChI | InChI=1S/C16H19NO6/c1-9(18)13(16(21)23-4)14(17-10(2)19)11-7-5-6-8-12(11)15(20)22-3/h5-8,13-14H,1-4H3,(H,17,19)/t13-,14+/m1/s1 |
| InChIKey | RVTTYPUHUKXKDK-KGLIPLIRSA-N |
| XLogP | 1.03 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|