C16H27NO2SSi — CID 10496308
2-[4-benzylsulfanylbutyl(trimethylsilyl)amino]acetic acid (PubChem CID 10496308) has the molecular formula C16H27NO2SSi and a molecular weight of 325.55 g/mol. Its IUPAC name is 2-[4-benzylsulfanylbutyl(trimethylsilyl)amino]acetic acid.
| Compound Name | 2-[4-benzylsulfanylbutyl(trimethylsilyl)amino]acetic acid |
|---|---|
| PubChem CID | 10496308 |
| Molecular Formula | C16H27NO2SSi |
| Molecular Weight | 325.55 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[4-benzylsulfanylbutyl(trimethylsilyl)amino]acetic acid |
| SMILES | C[Si](C)(C)N(CCCCSCc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C16H27NO2SSi/c1-21(2,3)17(13-16(18)19)11-7-8-12-20-14-15-9-5-4-6-10-15/h4-6,9-10H,7-8,11-14H2,1-3H3,(H,18,19) |
| InChIKey | QENFMBQHZSAGFY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|