C24H31NO4S2 — CID 10813887
(2S)-2-[bis(3-benzylsulfanylpropyl)amino]butanedioic acid (PubChem CID 10813887) has the molecular formula C24H31NO4S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is (2S)-2-[bis(3-benzylsulfanylpropyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[bis(3-benzylsulfanylpropyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 10813887 |
| Molecular Formula | C24H31NO4S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (2S)-2-[bis(3-benzylsulfanylpropyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](C(=O)O)N(CCCSCc1ccccc1)CCCSCc1ccccc1 |
| InChI | InChI=1S/C24H31NO4S2/c26-23(27)17-22(24(28)29)25(13-7-15-30-18-20-9-3-1-4-10-20)14-8-16-31-19-21-11-5-2-6-12-21/h1-6,9-12,22H,7-8,13-19H2,(H,26,27)(H,28,29)/t22-/m0/s1 |
| InChIKey | YHWZWXYKRNMTJV-QFIPXVFZSA-N |
| XLogP | 4.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|