C18H27NO3S — CID 58275037
6-[2-benzylsulfanylethyl(propanoyl)amino]hexanoic acid (PubChem CID 58275037) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 6-[2-benzylsulfanylethyl(propanoyl)amino]hexanoic acid.
| Compound Name | 6-[2-benzylsulfanylethyl(propanoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 58275037 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 6-[2-benzylsulfanylethyl(propanoyl)amino]hexanoic acid |
| SMILES | CCC(=O)N(CCCCCC(=O)O)CCSCc1ccccc1 |
| InChI | InChI=1S/C18H27NO3S/c1-2-17(20)19(12-8-4-7-11-18(21)22)13-14-23-15-16-9-5-3-6-10-16/h3,5-6,9-10H,2,4,7-8,11-15H2,1H3,(H,21,22) |
| InChIKey | FKJKEMAEFPDYGB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|