C21H34OSi — CID 10496686
[(2E)-1-(8,8-dimethyl-4,5,6,7-tetrahydro-1H-naphthalen-2-yl)-3-methylpenta-2,4-dienoxy]-trimethylsilane (PubChem CID 10496686) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is [(2E)-1-(8,8-dimethyl-4,5,6,7-tetrahydro-1H-naphthalen-2-yl)-3-methylpenta-2,4-dienoxy]-trimethylsilane.
| Compound Name | [(2E)-1-(8,8-dimethyl-4,5,6,7-tetrahydro-1H-naphthalen-2-yl)-3-methylpenta-2,4-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10496686 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(2E)-1-(8,8-dimethyl-4,5,6,7-tetrahydro-1H-naphthalen-2-yl)-3-methylpenta-2,4-dienoxy]-trimethylsilane |
| SMILES | C=C/C(C)=C/C(O[Si](C)(C)C)C1=CCC2=C(C1)C(C)(C)CCC2 |
| InChI | InChI=1S/C21H34OSi/c1-8-16(2)14-20(22-23(5,6)7)18-12-11-17-10-9-13-21(3,4)19(17)15-18/h8,12,14,20H,1,9-11,13,15H2,2-7H3/b16-14+ |
| InChIKey | OQCPFCUGIDGGAN-JQIJEIRASA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|