C21H35BrOSi — CID 134835260
[(6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134835260) has the molecular formula C21H35BrOSi and a molecular weight of 411.50 g/mol. Its IUPAC name is [(6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134835260 |
| Molecular Formula | C21H35BrOSi |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)CC(C)(C)[C@@]12C=CC(=CBr)CC2 |
| InChI | InChI=1S/C21H35BrOSi/c1-16-13-18(23-24(7,8)19(2,3)4)14-20(5,6)21(16)11-9-17(15-22)10-12-21/h9,11,13,15,18H,10,12,14H2,1-8H3/t18?,21-/m1/s1 |
| InChIKey | IXUBDPOEDGLTHD-BDPMCISCSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|