C24H38OSi — CID 101025341
[(S)-(6-ethenyl-6-methylcyclohexen-1-yl)-(5-ethenyl-4,6,6-trimethylcyclohexa-1,4-dien-1-yl)methoxy]-trimethylsilane (PubChem CID 101025341) has the molecular formula C24H38OSi and a molecular weight of 370.65 g/mol. Its IUPAC name is [(S)-(6-ethenyl-6-methylcyclohexen-1-yl)-(5-ethenyl-4,6,6-trimethylcyclohexa-1,4-dien-1-yl)methoxy]-trimethylsilane.
| Compound Name | [(S)-(6-ethenyl-6-methylcyclohexen-1-yl)-(5-ethenyl-4,6,6-trimethylcyclohexa-1,4-dien-1-yl)methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101025341 |
| Molecular Formula | C24H38OSi |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(S)-(6-ethenyl-6-methylcyclohexen-1-yl)-(5-ethenyl-4,6,6-trimethylcyclohexa-1,4-dien-1-yl)methoxy]-trimethylsilane |
| SMILES | C=CC1=C(C)CC=C([C@@H](O[Si](C)(C)C)C2=CCCCC2(C)C=C)C1(C)C |
| InChI | InChI=1S/C24H38OSi/c1-10-19-18(3)15-16-20(23(19,4)5)22(25-26(7,8)9)21-14-12-13-17-24(21,6)11-2/h10-11,14,16,22H,1-2,12-13,15,17H2,3-9H3/t22-,24?/m1/s1 |
| InChIKey | SIKGPIKNSXZKKP-LETIRJCYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|