C27H44OSi — CID 56851269
tert-butyl-[3-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-2,4,4-trimethylcyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 56851269) has the molecular formula C27H44OSi and a molecular weight of 412.73 g/mol. Its IUPAC name is tert-butyl-[3-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-2,4,4-trimethylcyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-2,4,4-trimethylcyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 56851269 |
| Molecular Formula | C27H44OSi |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-[3-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-2,4,4-trimethylcyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(O[Si](C)(C)C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C27H44OSi/c1-12-14-21(2)15-13-16-22(3)17-18-24-23(4)25(19-20-27(24,8)9)28-29(10,11)26(5,6)7/h12-18,25H,1,19-20H2,2-11H3/b15-13+,18-17+,21-14+,22-16+ |
| InChIKey | SXQUTZQZNCWQBB-MDGDMJOWSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|