C20H36OSi — CID 44521640
tert-butyl-dimethyl-[2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 44521640) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 44521640 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl-dimethyl-[2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | C=C(C)/C=C/C1=C(C)C(O[Si](C)(C)C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C20H36OSi/c1-15(2)11-12-17-16(3)18(13-14-20(17,7)8)21-22(9,10)19(4,5)6/h11-12,18H,1,13-14H2,2-10H3/b12-11+ |
| InChIKey | RGRHAELYPHITAP-VAWYXSNFSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|