C26H47BrOSi — CID 11092087
[(E,2E)-2-(2-bromoethylidene)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11092087) has the molecular formula C26H47BrOSi and a molecular weight of 483.65 g/mol. Its IUPAC name is [(E,2E)-2-(2-bromoethylidene)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,2E)-2-(2-bromoethylidene)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11092087 |
| Molecular Formula | C26H47BrOSi |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | [(E,2E)-2-(2-bromoethylidene)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1=C(CC/C(C)=C/CC/C(=C\CBr)CO[Si](C)(C)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H47BrOSi/c1-21(15-16-24-22(2)13-11-18-26(24,6)7)12-10-14-23(17-19-27)20-28-29(8,9)25(3,4)5/h12,17H,10-11,13-16,18-20H2,1-9H3/b21-12+,23-17+ |
| InChIKey | VKMSGLGPASGDFK-RHAPCSKMSA-N |
| XLogP | 9.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|