C19H37BrOSi — CID 11452085
[(1R,6S)-2-(bromomethyl)-1,6-dimethylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 11452085) has the molecular formula C19H37BrOSi and a molecular weight of 389.49 g/mol. Its IUPAC name is [(1R,6S)-2-(bromomethyl)-1,6-dimethylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,6S)-2-(bromomethyl)-1,6-dimethylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11452085 |
| Molecular Formula | C19H37BrOSi |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(1R,6S)-2-(bromomethyl)-1,6-dimethylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@]1(C)C(CBr)=CCC[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H37BrOSi/c1-14(2)22(15(3)4,16(5)6)21-13-19(8)17(7)10-9-11-18(19)12-20/h11,14-17H,9-10,12-13H2,1-8H3/t17-,19+/m0/s1 |
| InChIKey | XEOJKWVIYGTCAG-PKOBYXMFSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|